C38H44N6O3 — CID 163297928
2-[(Z)-2-amino-3-[amino(benzyl)amino]prop-2-enoxy]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 163297928) has the molecular formula C38H44N6O3 and a molecular weight of 632.81 g/mol. Its IUPAC name is 2-[(Z)-2-amino-3-[amino(benzyl)amino]prop-2-enoxy]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-[(Z)-2-amino-3-[amino(benzyl)amino]prop-2-enoxy]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 163297928 |
| Molecular Formula | C38H44N6O3 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | 2-[(Z)-2-amino-3-[amino(benzyl)amino]prop-2-enoxy]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1OC/C(N)=C/N(N)Cc1ccccc1 |
| InChI | InChI=1S/C38H44N6O3/c1-5-41(6-2)29-18-20-33-35(22-29)47-36-23-30(42(7-3)8-4)19-21-34(36)38(33)32-17-13-12-16-31(32)37(45)44(38)46-26-28(39)25-43(40)24-27-14-10-9-11-15-27/h9-23,25H,5-8,24,26,39-40H2,1-4H3/b28-25- |
| InChIKey | ZEQANVVUUOBKBK-FVDSYPCUSA-N |
| XLogP | 6.34 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|