C17H15F9N4O3 — CID 163299166
1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[2-(trifluoromethyl)pyrimidin-4-yl]carbamoyl]-6-azaspiro[2.5]octane-6-carboxylate (PubChem CID 163299166) has the molecular formula C17H15F9N4O3 and a molecular weight of 494.31 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[2-(trifluoromethyl)pyrimidin-4-yl]carbamoyl]-6-azaspiro[2.5]octane-6-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[2-(trifluoromethyl)pyrimidin-4-yl]carbamoyl]-6-azaspiro[2.5]octane-6-carboxylate |
|---|---|
| PubChem CID | 163299166 |
| Molecular Formula | C17H15F9N4O3 |
| Molecular Weight | 494.31 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[2-(trifluoromethyl)pyrimidin-4-yl]carbamoyl]-6-azaspiro[2.5]octane-6-carboxylate |
| SMILES | O=C(Nc1ccnc(C(F)(F)F)n1)C1CC12CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2 |
| InChI | InChI=1S/C17H15F9N4O3/c18-15(19,20)11(16(21,22)23)33-13(32)30-5-2-14(3-6-30)7-8(14)10(31)28-9-1-4-27-12(29-9)17(24,25)26/h1,4,8,11H,2-3,5-7H2,(H,27,28,29,31) |
| InChIKey | LPPYOBBNBXDNIB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |