C33H41FN4O2S — CID 163299264
N'-[[1-(benzenesulfonyl)indol-3-yl]methyl]-N-cyclohexyl-N-ethyl-N'-[(2-fluoro-3-pyridinyl)methyl]butane-1,4-diamine (PubChem CID 163299264) has the molecular formula C33H41FN4O2S and a molecular weight of 576.78 g/mol. Its IUPAC name is N'-[[1-(benzenesulfonyl)indol-3-yl]methyl]-N-cyclohexyl-N-ethyl-N'-[(2-fluoro-3-pyridinyl)methyl]butane-1,4-diamine.
| Compound Name | N'-[[1-(benzenesulfonyl)indol-3-yl]methyl]-N-cyclohexyl-N-ethyl-N'-[(2-fluoro-3-pyridinyl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 163299264 |
| Molecular Formula | C33H41FN4O2S |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | N'-[[1-(benzenesulfonyl)indol-3-yl]methyl]-N-cyclohexyl-N-ethyl-N'-[(2-fluoro-3-pyridinyl)methyl]butane-1,4-diamine |
| SMILES | CCN(CCCCN(Cc1cccnc1F)Cc1cn(S(=O)(=O)c2ccccc2)c2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C33H41FN4O2S/c1-2-37(29-15-5-3-6-16-29)23-12-11-22-36(24-27-14-13-21-35-33(27)34)25-28-26-38(32-20-10-9-19-31(28)32)41(39,40)30-17-7-4-8-18-30/h4,7-10,13-14,17-21,26,29H,2-3,5-6,11-12,15-16,22-25H2,1H3 |
| InChIKey | UONYJLMCWYQQEV-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|