C32H40N4O2S — CID 163299434
N'-[[1-(benzenesulfonyl)indol-3-yl]methyl]-N-cyclohexyl-N'-(pyridin-4-ylmethyl)pentane-1,5-diamine (PubChem CID 163299434) has the molecular formula C32H40N4O2S and a molecular weight of 544.77 g/mol. Its IUPAC name is N'-[[1-(benzenesulfonyl)indol-3-yl]methyl]-N-cyclohexyl-N'-(pyridin-4-ylmethyl)pentane-1,5-diamine.
| Compound Name | N'-[[1-(benzenesulfonyl)indol-3-yl]methyl]-N-cyclohexyl-N'-(pyridin-4-ylmethyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 163299434 |
| Molecular Formula | C32H40N4O2S |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | N'-[[1-(benzenesulfonyl)indol-3-yl]methyl]-N-cyclohexyl-N'-(pyridin-4-ylmethyl)pentane-1,5-diamine |
| SMILES | O=S(=O)(c1ccccc1)n1cc(CN(CCCCCNC2CCCCC2)Cc2ccncc2)c2ccccc21 |
| InChI | InChI=1S/C32H40N4O2S/c37-39(38,30-14-6-2-7-15-30)36-26-28(31-16-8-9-17-32(31)36)25-35(24-27-18-21-33-22-19-27)23-11-3-10-20-34-29-12-4-1-5-13-29/h2,6-9,14-19,21-22,26,29,34H,1,3-5,10-13,20,23-25H2 |
| InChIKey | DSJDTZRJNSJKPP-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|