About butyl 2-hydroxybenzoate
butyl 2-hydroxybenzoate (PubChem CID 16330) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is butyl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | butyl 2-hydroxybenzoate |
| PubChem CID | 16330 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | butyl 2-hydroxybenzoate |
| SMILES | CCCCOC(=O)c1ccccc1O |
| InChI | InChI=1S/C11H14O3/c1-2-3-8-14-11(13)9-6-4-5-7-10(9)12/h4-7,12H,2-3,8H2,1H3 |
| InChIKey | YFDUWSBGVPBWKF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-hydroxybenzoate?
The IUPAC name of butyl 2-hydroxybenzoate (CID 16330) is butyl 2-hydroxybenzoate.
What is the SMILES notation for butyl 2-hydroxybenzoate?
The canonical SMILES for butyl 2-hydroxybenzoate is CCCCOC(=O)c1ccccc1O.
What is the InChIKey of butyl 2-hydroxybenzoate?
The InChIKey is YFDUWSBGVPBWKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-2-3-8-14-11(13)9-6-4-5-7-10(9)12/h4-7,12H,2-3,8H2,1H3.
What are the key properties of butyl 2-hydroxybenzoate?
butyl 2-hydroxybenzoate has a molecular weight of 194.23 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-hydroxybenzoate is sourced from PubChem (CID 16330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).