C18H30N6O3 — CID 163300575
1-[2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-2-cyclobutylacetyl]-N-(2-amino-2-oxoethyl)pyrrolidine-2-carboxamide (PubChem CID 163300575) has the molecular formula C18H30N6O3 and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-[2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-2-cyclobutylacetyl]-N-(2-amino-2-oxoethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-2-cyclobutylacetyl]-N-(2-amino-2-oxoethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163300575 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1-[2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-2-cyclobutylacetyl]-N-(2-amino-2-oxoethyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)CNC(=O)C1CCCN1C(=O)C(C1CCC1)N(N)/C=C(\N)C1CC1 |
| InChI | InChI=1S/C18H30N6O3/c19-13(11-6-7-11)10-24(21)16(12-3-1-4-12)18(27)23-8-2-5-14(23)17(26)22-9-15(20)25/h10-12,14,16H,1-9,19,21H2,(H2,20,25)(H,22,26)/b13-10- |
| InChIKey | PIQBWYPCLOSIML-RAXLEYEMSA-N |
| XLogP | -0.87 |
| TPSA | 147.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|