C26H36N4O3 — CID 163300688
2-amino-3-methyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;(2R)-2-formamido-3-(4-phenylphenyl)propanamide (PubChem CID 163300688) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-amino-3-methyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;(2R)-2-formamido-3-(4-phenylphenyl)propanamide.
| Compound Name | 2-amino-3-methyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;(2R)-2-formamido-3-(4-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 163300688 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 2-amino-3-methyl-1-(2-methylpyrrolidin-1-yl)butan-1-one;(2R)-2-formamido-3-(4-phenylphenyl)propanamide |
| SMILES | CC(C)C(N)C(=O)N1CCCC1C.NC(=O)[C@@H](Cc1ccc(-c2ccccc2)cc1)NC=O |
| InChI | InChI=1S/C16H16N2O2.C10H20N2O/c17-16(20)15(18-11-19)10-12-6-8-14(9-7-12)13-4-2-1-3-5-13;1-7(2)9(11)10(13)12-6-4-5-8(12)3/h1-9,11,15H,10H2,(H2,17,20)(H,18,19);7-9H,4-6,11H2,1-3H3/t15-;/m1./s1 |
| InChIKey | IOHHWNRNHGPJAM-XFULWGLBSA-N |
| XLogP | 2.48 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|