About [(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate
[(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate (PubChem CID 163300811) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is [(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate.
Molecular Properties
| Compound Name | [(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate |
| PubChem CID | 163300811 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | [(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate |
| SMILES | CC(=O)O[C@@H](C1C=CC=CC1)[C@H](C)N(C)C(C)=O |
| InChI | InChI=1S/C14H21NO3/c1-10(15(4)11(2)16)14(18-12(3)17)13-8-6-5-7-9-13/h5-8,10,13-14H,9H2,1-4H3/t10-,13?,14+/m0/s1 |
| InChIKey | UXTPEWFJYKPKDG-WOPFXOFLSA-N |
| XLogP | 1.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate?
The IUPAC name of [(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate (CID 163300811) is [(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate.
What is the SMILES notation for [(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate?
The canonical SMILES for [(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate is CC(=O)O[C@@H](C1C=CC=CC1)[C@H](C)N(C)C(C)=O.
What is the InChIKey of [(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate?
The InChIKey is UXTPEWFJYKPKDG-WOPFXOFLSA-N. The full InChI is InChI=1S/C14H21NO3/c1-10(15(4)11(2)16)14(18-12(3)17)13-8-6-5-7-9-13/h5-8,10,13-14H,9H2,1-4H3/t10-,13?,14+/m0/s1.
What are the key properties of [(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate?
[(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate has a molecular weight of 251.33 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-[acetyl(methyl)amino]-1-cyclohexa-2,4-dien-1-ylpropyl] acetate is sourced from PubChem (CID 163300811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).