About tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane
tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane (PubChem CID 163301971) has the molecular formula C18H29ClN4O3
and a molecular weight of 384.91 g/mol. Its IUPAC name is tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane.
Molecular Properties
| Compound Name | tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane |
| PubChem CID | 163301971 |
| Molecular Formula | C18H29ClN4O3 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane |
| SMILES | CC.CC(C)(C)OC=O.CNC1CC(Oc2nc(Cl)cn3nccc23)C1 |
| InChI | InChI=1S/C11H13ClN4O.C5H10O2.C2H6/c1-13-7-4-8(5-7)17-11-9-2-3-14-16(9)6-10(12)15-11;1-5(2,3)7-4-6;1-2/h2-3,6-8,13H,4-5H2,1H3;4H,1-3H3;1-2H3 |
| InChIKey | TYQVIOQCIJNPLC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane?
The IUPAC name of tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane (CID 163301971) is tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane.
What is the SMILES notation for tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane?
The canonical SMILES for tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane is CC.CC(C)(C)OC=O.CNC1CC(Oc2nc(Cl)cn3nccc23)C1.
What is the InChIKey of tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane?
The InChIKey is TYQVIOQCIJNPLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN4O.C5H10O2.C2H6/c1-13-7-4-8(5-7)17-11-9-2-3-14-16(9)6-10(12)15-11;1-5(2,3)7-4-6;1-2/h2-3,6-8,13H,4-5H2,1H3;4H,1-3H3;1-2H3.
What are the key properties of tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane?
tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane has a molecular weight of 384.91 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;3-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)oxy-N-methylcyclobutan-1-amine;ethane is sourced from PubChem (CID 163301971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).