C12H20N2O — CID 163302282
ethane;7-methyl-1H-imidazo[1,2-a]pyridin-5-one (PubChem CID 163302282) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is ethane;7-methyl-1H-imidazo[1,2-a]pyridin-5-one.
| Compound Name | ethane;7-methyl-1H-imidazo[1,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 163302282 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | ethane;7-methyl-1H-imidazo[1,2-a]pyridin-5-one |
| SMILES | CC.CC.Cc1cc(=O)n2cc[nH]c2c1 |
| InChI | InChI=1S/C8H8N2O.2C2H6/c1-6-4-7-9-2-3-10(7)8(11)5-6;2*1-2/h2-5,9H,1H3;2*1-2H3 |
| InChIKey | JHRNQDDYKBNWQX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |