C21H32N2O2 — CID 163302422
(1R,4aS,10aR)-N-[2-(dimethylamino)ethyl]-6-hydroxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide (PubChem CID 163302422) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is (1R,4aS,10aR)-N-[2-(dimethylamino)ethyl]-6-hydroxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide.
| Compound Name | (1R,4aS,10aR)-N-[2-(dimethylamino)ethyl]-6-hydroxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 163302422 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | (1R,4aS,10aR)-N-[2-(dimethylamino)ethyl]-6-hydroxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
| SMILES | CN(C)CCNC(=O)[C@]1(C)CCC[C@]2(C)c3cc(O)ccc3CC[C@@H]12 |
| InChI | InChI=1S/C21H32N2O2/c1-20-10-5-11-21(2,19(25)22-12-13-23(3)4)18(20)9-7-15-6-8-16(24)14-17(15)20/h6,8,14,18,24H,5,7,9-13H2,1-4H3,(H,22,25)/t18-,20-,21-/m1/s1 |
| InChIKey | UROQAMUUNSDSST-HMXCVIKNSA-N |
| XLogP | 3.08 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |