C16H14F2N6 — CID 163302554
(Z)-[9-(2,6-difluorophenyl)-2,4,5,8,10-pentazatricyclo[8.4.0.03,7]tetradeca-1,3(7),5,8-tetraen-14-ylidene]methanamine (PubChem CID 163302554) has the molecular formula C16H14F2N6 and a molecular weight of 328.33 g/mol. Its IUPAC name is (Z)-[9-(2,6-difluorophenyl)-2,4,5,8,10-pentazatricyclo[8.4.0.03,7]tetradeca-1,3(7),5,8-tetraen-14-ylidene]methanamine.
| Compound Name | (Z)-[9-(2,6-difluorophenyl)-2,4,5,8,10-pentazatricyclo[8.4.0.03,7]tetradeca-1,3(7),5,8-tetraen-14-ylidene]methanamine |
|---|---|
| PubChem CID | 163302554 |
| Molecular Formula | C16H14F2N6 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (Z)-[9-(2,6-difluorophenyl)-2,4,5,8,10-pentazatricyclo[8.4.0.03,7]tetradeca-1,3(7),5,8-tetraen-14-ylidene]methanamine |
| SMILES | N/C=C1/CCCN2C1=Nc1[nH]ncc1N=C2c1c(F)cccc1F |
| InChI | InChI=1S/C16H14F2N6/c17-10-4-1-5-11(18)13(10)16-21-12-8-20-23-14(12)22-15-9(7-19)3-2-6-24(15)16/h1,4-5,7-8H,2-3,6,19H2,(H,20,23)/b9-7- |
| InChIKey | CNLWQWQGMNKWQY-CLFYSBASSA-N |
| XLogP | 2.75 |
| TPSA | 82.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |