C16H12ClFN6 — CID 163302593
8-(2-chloro-6-fluorophenyl)-5-methyl-3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2,5,7,13-pentaene (PubChem CID 163302593) has the molecular formula C16H12ClFN6 and a molecular weight of 342.77 g/mol. Its IUPAC name is 8-(2-chloro-6-fluorophenyl)-5-methyl-3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2,5,7,13-pentaene.
| Compound Name | 8-(2-chloro-6-fluorophenyl)-5-methyl-3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2,5,7,13-pentaene |
|---|---|
| PubChem CID | 163302593 |
| Molecular Formula | C16H12ClFN6 |
| Molecular Weight | 342.77 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 8-(2-chloro-6-fluorophenyl)-5-methyl-3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2,5,7,13-pentaene |
| SMILES | Cc1[nH]nc2c1N=C(c1c(F)cccc1Cl)N1CCn3ncc-2c31 |
| InChI | InChI=1S/C16H12ClFN6/c1-8-13-14(22-21-8)9-7-19-24-6-5-23(16(9)24)15(20-13)12-10(17)3-2-4-11(12)18/h2-4,7H,5-6H2,1H3,(H,21,22) |
| InChIKey | WDPCKSSBRGRLBV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.77 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |