C17H17F2N5 — CID 163302680
[6-butyl-5-(2,6-difluorophenyl)-1H-pyrazolo[4,5-d][1,3]diazepin-8-yl]methanimine (PubChem CID 163302680) has the molecular formula C17H17F2N5 and a molecular weight of 329.35 g/mol. Its IUPAC name is [6-butyl-5-(2,6-difluorophenyl)-1H-pyrazolo[4,5-d][1,3]diazepin-8-yl]methanimine.
| Compound Name | [6-butyl-5-(2,6-difluorophenyl)-1H-pyrazolo[4,5-d][1,3]diazepin-8-yl]methanimine |
|---|---|
| PubChem CID | 163302680 |
| Molecular Formula | C17H17F2N5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | [6-butyl-5-(2,6-difluorophenyl)-1H-pyrazolo[4,5-d][1,3]diazepin-8-yl]methanimine |
| SMILES | [H]/N=C/C1=CN(CCCC)C(c2c(F)cccc2F)=Nc2cn[nH]c21 |
| InChI | InChI=1S/C17H17F2N5/c1-2-3-7-24-10-11(8-20)16-14(9-21-23-16)22-17(24)15-12(18)5-4-6-13(15)19/h4-6,8-10,20H,2-3,7H2,1H3,(H,21,23)/b20-8+ |
| InChIKey | CKTHMSHSTHKCLM-DNTJNYDQSA-N |
| XLogP | 3.87 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|