C20H39N5O2 — CID 163302941
2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-3,3-dimethylbutanal;2-cyclopropyl-1-methylpyrrolidine;formamide (PubChem CID 163302941) has the molecular formula C20H39N5O2 and a molecular weight of 381.57 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-3,3-dimethylbutanal;2-cyclopropyl-1-methylpyrrolidine;formamide.
| Compound Name | 2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-3,3-dimethylbutanal;2-cyclopropyl-1-methylpyrrolidine;formamide |
|---|---|
| PubChem CID | 163302941 |
| Molecular Formula | C20H39N5O2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.31 |
| IUPAC Name | 2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-3,3-dimethylbutanal;2-cyclopropyl-1-methylpyrrolidine;formamide |
| SMILES | CC(C)(C)C(C=O)N(N)/C=C(\N)C1CC1.CN1CCCC1C1CC1.NC=O |
| InChI | InChI=1S/C11H21N3O.C8H15N.CH3NO/c1-11(2,3)10(7-15)14(13)6-9(12)8-4-5-8;1-9-6-2-3-8(9)7-4-5-7;2-1-3/h6-8,10H,4-5,12-13H2,1-3H3;7-8H,2-6H2,1H3;1H,(H2,2,3)/b9-6-;; |
| InChIKey | ACXCSFATBUJOCW-MPTFJDTDSA-N |
| XLogP | 1.58 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|