About 7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol
7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol (PubChem CID 163303372) has the molecular formula C17H13BrN2OS
and a molecular weight of 373.28 g/mol. Its IUPAC name is 7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol.
Molecular Properties
| Compound Name | 7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol |
| PubChem CID | 163303372 |
| Molecular Formula | C17H13BrN2OS |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol |
| SMILES | OC1(c2cccc(-c3nc(Br)cs3)c2)CCc2cccnc21 |
| InChI | InChI=1S/C17H13BrN2OS/c18-14-10-22-16(20-14)12-3-1-5-13(9-12)17(21)7-6-11-4-2-8-19-15(11)17/h1-5,8-10,21H,6-7H2 |
| InChIKey | LGDKUGUVQVRSQF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol?
The IUPAC name of 7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol (CID 163303372) is 7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol.
What is the SMILES notation for 7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol?
The canonical SMILES for 7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol is OC1(c2cccc(-c3nc(Br)cs3)c2)CCc2cccnc21.
What is the InChIKey of 7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol?
The InChIKey is LGDKUGUVQVRSQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrN2OS/c18-14-10-22-16(20-14)12-3-1-5-13(9-12)17(21)7-6-11-4-2-8-19-15(11)17/h1-5,8-10,21H,6-7H2.
What are the key properties of 7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol?
7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol has a molecular weight of 373.28 g/mol, XLogP of 4.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-(4-bromo-1,3-thiazol-2-yl)phenyl]-5,6-dihydrocyclopenta[b]pyridin-7-ol is sourced from PubChem (CID 163303372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).