C17H19N3O2 — CID 163304657
3-[4-(1-ethoxyethyl)phenyl]-8-methoxyimidazo[1,2-a]pyrazine (PubChem CID 163304657) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 3-[4-(1-ethoxyethyl)phenyl]-8-methoxyimidazo[1,2-a]pyrazine.
| Compound Name | 3-[4-(1-ethoxyethyl)phenyl]-8-methoxyimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 163304657 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-[4-(1-ethoxyethyl)phenyl]-8-methoxyimidazo[1,2-a]pyrazine |
| SMILES | CCOC(C)c1ccc(-c2cnc3c(OC)nccn23)cc1 |
| InChI | InChI=1S/C17H19N3O2/c1-4-22-12(2)13-5-7-14(8-6-13)15-11-19-16-17(21-3)18-9-10-20(15)16/h5-12H,4H2,1-3H3 |
| InChIKey | FGTODGNPHWLARE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |