C25H33N3O2 — CID 163304661
(1R,2S,8S,9S)-11-(8-methoxy-4-methylquinolin-2-yl)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 163304661) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-(8-methoxy-4-methylquinolin-2-yl)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-11-(8-methoxy-4-methylquinolin-2-yl)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 163304661 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | (1R,2S,8S,9S)-11-(8-methoxy-4-methylquinolin-2-yl)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CCC[C@H]1[C@H]2C[C@H](CN(c3cc(C)c4cccc(OC)c4n3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C25H33N3O2/c1-4-7-20-17-13-18(21-9-6-11-24(29)28(20)21)15-27(14-17)23-12-16(2)19-8-5-10-22(30-3)25(19)26-23/h5,8,10,12,17-18,20-21H,4,6-7,9,11,13-15H2,1-3H3/t17-,18+,20-,21-/m0/s1 |
| InChIKey | FLPFBRWIKKYJEP-YHELAOLJSA-N |
| XLogP | 4.56 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |