C22H22N2O4 — CID 163306576
2-[4-(4-benzyl-1,3-oxazol-5-yl)phenoxy]-1-morpholin-4-ylethanone (PubChem CID 163306576) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-[4-(4-benzyl-1,3-oxazol-5-yl)phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-(4-benzyl-1,3-oxazol-5-yl)phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 163306576 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-[4-(4-benzyl-1,3-oxazol-5-yl)phenoxy]-1-morpholin-4-ylethanone |
| SMILES | O=C(COc1ccc(-c2ocnc2Cc2ccccc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H22N2O4/c25-21(24-10-12-26-13-11-24)15-27-19-8-6-18(7-9-19)22-20(23-16-28-22)14-17-4-2-1-3-5-17/h1-9,16H,10-15H2 |
| InChIKey | NKBXZSLIWZOMJD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |