About 2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol
2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol (PubChem CID 163307443) has the molecular formula C18H20FN5O2
and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol |
| PubChem CID | 163307443 |
| Molecular Formula | C18H20FN5O2 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol |
| SMILES | OCCn1nc(C2CCOCC2)nc1-c1cc(-c2ccccc2F)n[nH]1 |
| InChI | InChI=1S/C18H20FN5O2/c19-14-4-2-1-3-13(14)15-11-16(22-21-15)18-20-17(23-24(18)7-8-25)12-5-9-26-10-6-12/h1-4,11-12,25H,5-10H2,(H,21,22) |
| InChIKey | YZJIJAFYIKFCDM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol?
The IUPAC name of 2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol (CID 163307443) is 2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol.
What is the SMILES notation for 2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol?
The canonical SMILES for 2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol is OCCn1nc(C2CCOCC2)nc1-c1cc(-c2ccccc2F)n[nH]1.
What is the InChIKey of 2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol?
The InChIKey is YZJIJAFYIKFCDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FN5O2/c19-14-4-2-1-3-13(14)15-11-16(22-21-15)18-20-17(23-24(18)7-8-25)12-5-9-26-10-6-12/h1-4,11-12,25H,5-10H2,(H,21,22).
What are the key properties of 2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol?
2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol has a molecular weight of 357.39 g/mol, XLogP of 2.36, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]ethanol is sourced from PubChem (CID 163307443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).