C15H24N4O3 — CID 163307511
N-(4-methoxycyclohexyl)-2-methyl-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 163307511) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-(4-methoxycyclohexyl)-2-methyl-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | N-(4-methoxycyclohexyl)-2-methyl-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 163307511 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | N-(4-methoxycyclohexyl)-2-methyl-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | COC1CCC(NC(=O)C2CCc3nn(C)c(=O)n3C2)CC1 |
| InChI | InChI=1S/C15H24N4O3/c1-18-15(21)19-9-10(3-8-13(19)17-18)14(20)16-11-4-6-12(22-2)7-5-11/h10-12H,3-9H2,1-2H3,(H,16,20) |
| InChIKey | NJCAJTXUSDXVTK-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |