C16H21F3N2O3 — CID 163309144
[5-(pyrrolidin-1-ylmethyl)furan-2-yl]-[4-(trifluoromethoxy)piperidin-1-yl]methanone (PubChem CID 163309144) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is [5-(pyrrolidin-1-ylmethyl)furan-2-yl]-[4-(trifluoromethoxy)piperidin-1-yl]methanone.
| Compound Name | [5-(pyrrolidin-1-ylmethyl)furan-2-yl]-[4-(trifluoromethoxy)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 163309144 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [5-(pyrrolidin-1-ylmethyl)furan-2-yl]-[4-(trifluoromethoxy)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(CN2CCCC2)o1)N1CCC(OC(F)(F)F)CC1 |
| InChI | InChI=1S/C16H21F3N2O3/c17-16(18,19)24-12-5-9-21(10-6-12)15(22)14-4-3-13(23-14)11-20-7-1-2-8-20/h3-4,12H,1-2,5-11H2 |
| InChIKey | ABMWKTWNPGPRDW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |