C13H14N4OS — CID 163309388
(3aS,6aS)-5-(2-methylthieno[3,2-d]pyrimidin-4-yl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one (PubChem CID 163309388) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is (3aS,6aS)-5-(2-methylthieno[3,2-d]pyrimidin-4-yl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one.
| Compound Name | (3aS,6aS)-5-(2-methylthieno[3,2-d]pyrimidin-4-yl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 163309388 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (3aS,6aS)-5-(2-methylthieno[3,2-d]pyrimidin-4-yl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one |
| SMILES | Cc1nc(N2C[C@@H]3CNC(=O)[C@@H]3C2)c2sccc2n1 |
| InChI | InChI=1S/C13H14N4OS/c1-7-15-10-2-3-19-11(10)12(16-7)17-5-8-4-14-13(18)9(8)6-17/h2-3,8-9H,4-6H2,1H3,(H,14,18)/t8-,9+/m0/s1 |
| InChIKey | YEQGPLMCOBOSCU-DTWKUNHWSA-N |
| XLogP | 1.18 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |