C15H16N4O2 — CID 163309615
5-[5-(3-propoxyphenyl)furan-2-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 163309615) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 5-[5-(3-propoxyphenyl)furan-2-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[5-(3-propoxyphenyl)furan-2-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 163309615 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 5-[5-(3-propoxyphenyl)furan-2-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | CCCOc1cccc(-c2ccc(-c3nc(N)n[nH]3)o2)c1 |
| InChI | InChI=1S/C15H16N4O2/c1-2-8-20-11-5-3-4-10(9-11)12-6-7-13(21-12)14-17-15(16)19-18-14/h3-7,9H,2,8H2,1H3,(H3,16,17,18,19) |
| InChIKey | TUGKKWZTNQRRHF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |