C16H20N4O3 — CID 163309848
[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-(1-methylimidazo[2,1-e]pyrazol-7-yl)methanone (PubChem CID 163309848) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is [(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-(1-methylimidazo[2,1-e]pyrazol-7-yl)methanone.
| Compound Name | [(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-(1-methylimidazo[2,1-e]pyrazol-7-yl)methanone |
|---|---|
| PubChem CID | 163309848 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-(1-methylimidazo[2,1-e]pyrazol-7-yl)methanone |
| SMILES | Cn1ccn2ncc(C(=O)N3C[C@H]4[C@@H](CO)[C@@H]5CC[C@@]4(C3)O5)c12 |
| InChI | InChI=1S/C16H20N4O3/c1-18-4-5-20-14(18)10(6-17-20)15(22)19-7-12-11(8-21)13-2-3-16(12,9-19)23-13/h4-6,11-13,21H,2-3,7-9H2,1H3/t11-,12+,13+,16+/m1/s1 |
| InChIKey | SJHIIMLTINDBGY-DVZHBHJUSA-N |
| XLogP | 0.28 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |