C20H24N2O2S — CID 163311739
[(1R,5R,6S,7S)-3-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol (PubChem CID 163311739) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is [(1R,5R,6S,7S)-3-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol.
| Compound Name | [(1R,5R,6S,7S)-3-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol |
|---|---|
| PubChem CID | 163311739 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [(1R,5R,6S,7S)-3-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol |
| SMILES | Cc1ccccc1-c1ncc(CN2C[C@H]3[C@@H](CO)[C@@H]4CC[C@@]3(C2)O4)s1 |
| InChI | InChI=1S/C20H24N2O2S/c1-13-4-2-3-5-15(13)19-21-8-14(25-19)9-22-10-17-16(11-23)18-6-7-20(17,12-22)24-18/h2-5,8,16-18,23H,6-7,9-12H2,1H3/t16-,17+,18+,20+/m1/s1 |
| InChIKey | IQQWELMLORCIEF-LXZJYRNTSA-N |
| XLogP | 3.09 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |