C22H30FN3O — CID 163312133
(3aS,4S,7aR)-2-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl]-4-ethyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 163312133) has the molecular formula C22H30FN3O and a molecular weight of 371.50 g/mol. Its IUPAC name is (3aS,4S,7aR)-2-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl]-4-ethyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | (3aS,4S,7aR)-2-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl]-4-ethyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 163312133 |
| Molecular Formula | C22H30FN3O |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | (3aS,4S,7aR)-2-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl]-4-ethyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | CC[C@]1(O)CCC[C@H]2CN(Cc3cc(F)ccc3-n3nc(C)cc3C)C[C@H]21 |
| InChI | InChI=1S/C22H30FN3O/c1-4-22(27)9-5-6-17-12-25(14-20(17)22)13-18-11-19(23)7-8-21(18)26-16(3)10-15(2)24-26/h7-8,10-11,17,20,27H,4-6,9,12-14H2,1-3H3/t17-,20+,22-/m0/s1 |
| InChIKey | GZRXBWXURNXNFZ-WEYGHZABSA-N |
| XLogP | 4.00 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |