C17H21N5O3S — CID 163313037
[4,5-dimethyl-2-(tetrazol-1-yl)thiophen-3-yl]-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone (PubChem CID 163313037) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is [4,5-dimethyl-2-(tetrazol-1-yl)thiophen-3-yl]-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone.
| Compound Name | [4,5-dimethyl-2-(tetrazol-1-yl)thiophen-3-yl]-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone |
|---|---|
| PubChem CID | 163313037 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | [4,5-dimethyl-2-(tetrazol-1-yl)thiophen-3-yl]-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone |
| SMILES | Cc1sc(-n2cnnn2)c(C(=O)N2C[C@H]3[C@@H](CO)[C@@H]4CC[C@@]3(C2)O4)c1C |
| InChI | InChI=1S/C17H21N5O3S/c1-9-10(2)26-16(22-8-18-19-20-22)14(9)15(24)21-5-12-11(6-23)13-3-4-17(12,7-21)25-13/h8,11-13,23H,3-7H2,1-2H3/t11-,12+,13+,17+/m1/s1 |
| InChIKey | OMDNDODWRNBWOQ-XREXNNHRSA-N |
| XLogP | 0.95 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |