C24H32N4O3 — CID 163313387
(1R,8S,9S)-11-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 163313387) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is (1R,8S,9S)-11-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,8S,9S)-11-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 163313387 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (1R,8S,9S)-11-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cc1nc(C)c(CC(=O)N2C[C@H]3C[C@@H](C2)[C@H](CCC(C)C)n2c3cccc2=O)c(=O)[nH]1 |
| InChI | InChI=1S/C24H32N4O3/c1-14(2)8-9-21-18-10-17(20-6-5-7-22(29)28(20)21)12-27(13-18)23(30)11-19-15(3)25-16(4)26-24(19)31/h5-7,14,17-18,21H,8-13H2,1-4H3,(H,25,26,31)/t17-,18+,21+/m1/s1 |
| InChIKey | RCKONTCNNMMSPR-LQWHRVPQSA-N |
| XLogP | 2.71 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |