C23H24N4O3 — CID 163313482
(1-benzylpyrazolo[5,4-b]pyridin-3-yl)-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone (PubChem CID 163313482) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is (1-benzylpyrazolo[5,4-b]pyridin-3-yl)-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone.
| Compound Name | (1-benzylpyrazolo[5,4-b]pyridin-3-yl)-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone |
|---|---|
| PubChem CID | 163313482 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (1-benzylpyrazolo[5,4-b]pyridin-3-yl)-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone |
| SMILES | O=C(c1nn(Cc2ccccc2)c2ncccc12)N1C[C@H]2[C@@H](CO)[C@@H]3CC[C@@]2(C1)O3 |
| InChI | InChI=1S/C23H24N4O3/c28-13-17-18-12-26(14-23(18)9-8-19(17)30-23)22(29)20-16-7-4-10-24-21(16)27(25-20)11-15-5-2-1-3-6-15/h1-7,10,17-19,28H,8-9,11-14H2/t17-,18+,19+,23+/m1/s1 |
| InChIKey | JYRYSIPOUBQCCF-XQQXVUDOSA-N |
| XLogP | 2.09 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |