C21H21N5O2 — CID 163313692
1-[3-(2-methoxyquinolin-3-yl)imidazo[1,2-a]pyrazin-8-yl]piperidin-4-ol (PubChem CID 163313692) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-[3-(2-methoxyquinolin-3-yl)imidazo[1,2-a]pyrazin-8-yl]piperidin-4-ol.
| Compound Name | 1-[3-(2-methoxyquinolin-3-yl)imidazo[1,2-a]pyrazin-8-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 163313692 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-[3-(2-methoxyquinolin-3-yl)imidazo[1,2-a]pyrazin-8-yl]piperidin-4-ol |
| SMILES | COc1nc2ccccc2cc1-c1cnc2c(N3CCC(O)CC3)nccn12 |
| InChI | InChI=1S/C21H21N5O2/c1-28-21-16(12-14-4-2-3-5-17(14)24-21)18-13-23-20-19(22-8-11-26(18)20)25-9-6-15(27)7-10-25/h2-5,8,11-13,15,27H,6-7,9-10H2,1H3 |
| InChIKey | VMMRLDYKCJSZCG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |