C16H17N3O4 — CID 163315075
[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-([1,2]oxazolo[3,4-b]pyridin-3-yl)methanone (PubChem CID 163315075) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is [(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-([1,2]oxazolo[3,4-b]pyridin-3-yl)methanone.
| Compound Name | [(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-([1,2]oxazolo[3,4-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 163315075 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | [(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-([1,2]oxazolo[3,4-b]pyridin-3-yl)methanone |
| SMILES | O=C(c1onc2ncccc12)N1C[C@H]2[C@@H](CO)[C@@H]3CC[C@@]2(C1)O3 |
| InChI | InChI=1S/C16H17N3O4/c20-7-10-11-6-19(8-16(11)4-3-12(10)22-16)15(21)13-9-2-1-5-17-14(9)18-23-13/h1-2,5,10-12,20H,3-4,6-8H2/t10-,11+,12+,16+/m1/s1 |
| InChIKey | LXQRADLCVOCVLS-YRORDHRNSA-N |
| XLogP | 0.83 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |