About (4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol
(4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol (PubChem CID 163315432) has the molecular formula C16H24FN3O3
and a molecular weight of 325.38 g/mol. Its IUPAC name is (4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol.
Molecular Properties
| Compound Name | (4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol |
| PubChem CID | 163315432 |
| Molecular Formula | C16H24FN3O3 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol |
| SMILES | CCc1ncnc(N2CCC3(CC2)OCC[C@@](C)(O)[C@@H]3O)c1F |
| InChI | InChI=1S/C16H24FN3O3/c1-3-11-12(17)13(19-10-18-11)20-7-4-16(5-8-20)14(21)15(2,22)6-9-23-16/h10,14,21-22H,3-9H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | AJHWRTZPFCNCBM-LSDHHAIUSA-N |
| XLogP | 1.05 |
| TPSA | 78.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol?
The IUPAC name of (4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol (CID 163315432) is (4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol.
What is the SMILES notation for (4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol?
The canonical SMILES for (4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol is CCc1ncnc(N2CCC3(CC2)OCC[C@@](C)(O)[C@@H]3O)c1F.
What is the InChIKey of (4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol?
The InChIKey is AJHWRTZPFCNCBM-LSDHHAIUSA-N. The full InChI is InChI=1S/C16H24FN3O3/c1-3-11-12(17)13(19-10-18-11)20-7-4-16(5-8-20)14(21)15(2,22)6-9-23-16/h10,14,21-22H,3-9H2,1-2H3/t14-,15+/m0/s1.
What are the key properties of (4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol?
(4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol has a molecular weight of 325.38 g/mol, XLogP of 1.05, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-9-(6-ethyl-5-fluoropyrimidin-4-yl)-4-methyl-1-oxa-9-azaspiro[5.5]undecane-4,5-diol is sourced from PubChem (CID 163315432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).