C19H21N3O5 — CID 163315875
methyl (3aS,6aS)-5-[(6-carbamoyl-4-oxo-1H-quinolin-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate (PubChem CID 163315875) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is methyl (3aS,6aS)-5-[(6-carbamoyl-4-oxo-1H-quinolin-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate.
| Compound Name | methyl (3aS,6aS)-5-[(6-carbamoyl-4-oxo-1H-quinolin-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 163315875 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | methyl (3aS,6aS)-5-[(6-carbamoyl-4-oxo-1H-quinolin-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate |
| SMILES | COC(=O)[C@@]12COC[C@@H]1CN(Cc1cc(=O)c3cc(C(N)=O)ccc3[nH]1)C2 |
| InChI | InChI=1S/C19H21N3O5/c1-26-18(25)19-9-22(6-12(19)8-27-10-19)7-13-5-16(23)14-4-11(17(20)24)2-3-15(14)21-13/h2-5,12H,6-10H2,1H3,(H2,20,24)(H,21,23)/t12-,19-/m0/s1 |
| InChIKey | CIWVSEVKRYJUCX-BUXKBTBVSA-N |
| XLogP | 0.25 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |