C21H28N4O2 — CID 163317448
2-phenyl-9-(1H-pyrrole-2-carbonyl)-1,5,9-triazacyclotridecan-4-one (PubChem CID 163317448) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-phenyl-9-(1H-pyrrole-2-carbonyl)-1,5,9-triazacyclotridecan-4-one.
| Compound Name | 2-phenyl-9-(1H-pyrrole-2-carbonyl)-1,5,9-triazacyclotridecan-4-one |
|---|---|
| PubChem CID | 163317448 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2-phenyl-9-(1H-pyrrole-2-carbonyl)-1,5,9-triazacyclotridecan-4-one |
| SMILES | O=C1CC(c2ccccc2)NCCCCN(C(=O)c2ccc[nH]2)CCCN1 |
| InChI | InChI=1S/C21H28N4O2/c26-20-16-19(17-8-2-1-3-9-17)23-11-4-5-14-25(15-7-13-24-20)21(27)18-10-6-12-22-18/h1-3,6,8-10,12,19,22-23H,4-5,7,11,13-16H2,(H,24,26) |
| InChIKey | QGJFBXZTHHXDJX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |