C13H14N2O — CID 163317973
[2-(4,5-dimethylpyridazin-3-yl)phenyl]methanol (PubChem CID 163317973) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is [2-(4,5-dimethylpyridazin-3-yl)phenyl]methanol.
| Compound Name | [2-(4,5-dimethylpyridazin-3-yl)phenyl]methanol |
|---|---|
| PubChem CID | 163317973 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | [2-(4,5-dimethylpyridazin-3-yl)phenyl]methanol |
| SMILES | Cc1cnnc(-c2ccccc2CO)c1C |
| InChI | InChI=1S/C13H14N2O/c1-9-7-14-15-13(10(9)2)12-6-4-3-5-11(12)8-16/h3-7,16H,8H2,1-2H3 |
| InChIKey | GLHRMHJJOHQYNN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |