C27H34O5 — CID 163319631
4-(2,10,15-trimethyl-5-phenyl-4,6,14-trioxatetracyclo[8.7.0.02,7.011,15]heptadecan-13-yl)-2H-furan-5-one (PubChem CID 163319631) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is 4-(2,10,15-trimethyl-5-phenyl-4,6,14-trioxatetracyclo[8.7.0.02,7.011,15]heptadecan-13-yl)-2H-furan-5-one.
| Compound Name | 4-(2,10,15-trimethyl-5-phenyl-4,6,14-trioxatetracyclo[8.7.0.02,7.011,15]heptadecan-13-yl)-2H-furan-5-one |
|---|---|
| PubChem CID | 163319631 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 4-(2,10,15-trimethyl-5-phenyl-4,6,14-trioxatetracyclo[8.7.0.02,7.011,15]heptadecan-13-yl)-2H-furan-5-one |
| SMILES | CC12CCC3C4(C)COC(c5ccccc5)OC4CCC3(C)C1CC(C1=CCOC1=O)O2 |
| InChI | InChI=1S/C27H34O5/c1-25-12-10-22-26(2,16-30-24(31-22)17-7-5-4-6-8-17)20(25)9-13-27(3)21(25)15-19(32-27)18-11-14-29-23(18)28/h4-8,11,19-22,24H,9-10,12-16H2,1-3H3 |
| InChIKey | QVABIBOCXNRAJD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |