C25H31BrO5S — CID 163319703
4-[5-(5-bromothiophen-2-yl)-2,10,15-trimethyl-4,6,14-trioxatetracyclo[8.7.0.02,7.011,15]heptadecan-13-yl]-2H-furan-5-one (PubChem CID 163319703) has the molecular formula C25H31BrO5S and a molecular weight of 523.49 g/mol. Its IUPAC name is 4-[5-(5-bromothiophen-2-yl)-2,10,15-trimethyl-4,6,14-trioxatetracyclo[8.7.0.02,7.011,15]heptadecan-13-yl]-2H-furan-5-one.
| Compound Name | 4-[5-(5-bromothiophen-2-yl)-2,10,15-trimethyl-4,6,14-trioxatetracyclo[8.7.0.02,7.011,15]heptadecan-13-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 163319703 |
| Molecular Formula | C25H31BrO5S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 4-[5-(5-bromothiophen-2-yl)-2,10,15-trimethyl-4,6,14-trioxatetracyclo[8.7.0.02,7.011,15]heptadecan-13-yl]-2H-furan-5-one |
| SMILES | CC12CCC3C4(C)COC(c5ccc(Br)s5)OC4CCC3(C)C1CC(C1=CCOC1=O)O2 |
| InChI | InChI=1S/C25H31BrO5S/c1-23-9-7-19-24(2,13-29-22(30-19)16-4-5-20(26)32-16)17(23)6-10-25(3)18(23)12-15(31-25)14-8-11-28-21(14)27/h4-5,8,15,17-19,22H,6-7,9-13H2,1-3H3 |
| InChIKey | ZOJJIMJGXZPLFH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |