C35H44N2O5 — CID 163319705
dimethyl (1S,4R,9R,10R,12S)-14-(2-cyanoethoxy)-5,9,18-trimethyl-23-propan-2-yl-19-azahexacyclo[10.9.2.01,10.04,9.013,21.016,20]tricosa-13,15,17,20,22-pentaene-5,17-dicarboxylate (PubChem CID 163319705) has the molecular formula C35H44N2O5 and a molecular weight of 572.75 g/mol. Its IUPAC name is dimethyl (1S,4R,9R,10R,12S)-14-(2-cyanoethoxy)-5,9,18-trimethyl-23-propan-2-yl-19-azahexacyclo[10.9.2.01,10.04,9.013,21.016,20]tricosa-13,15,17,20,22-pentaene-5,17-dicarboxylate.
| Compound Name | dimethyl (1S,4R,9R,10R,12S)-14-(2-cyanoethoxy)-5,9,18-trimethyl-23-propan-2-yl-19-azahexacyclo[10.9.2.01,10.04,9.013,21.016,20]tricosa-13,15,17,20,22-pentaene-5,17-dicarboxylate |
|---|---|
| PubChem CID | 163319705 |
| Molecular Formula | C35H44N2O5 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | dimethyl (1S,4R,9R,10R,12S)-14-(2-cyanoethoxy)-5,9,18-trimethyl-23-propan-2-yl-19-azahexacyclo[10.9.2.01,10.04,9.013,21.016,20]tricosa-13,15,17,20,22-pentaene-5,17-dicarboxylate |
| SMILES | COC(=O)c1c(C)[nH]c2c3c(c(OCCC#N)cc12)[C@H]1C[C@@H]2[C@@]4(C)CCCC(C)(C(=O)OC)[C@@H]4CC[C@@]32C=C1C(C)C |
| InChI | InChI=1S/C35H44N2O5/c1-19(2)23-18-35-13-10-25-33(4,11-8-12-34(25,5)32(39)41-7)26(35)17-21(23)28-24(42-15-9-14-36)16-22-27(31(38)40-6)20(3)37-30(22)29(28)35/h16,18-19,21,25-26,37H,8-13,15,17H2,1-7H3/t21-,25+,26+,33-,34?,35-/m0/s1 |
| InChIKey | BGHSQOGEBFHPEW-KZCTXIBJSA-N |
| XLogP | 7.27 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|