C18H33NO — CID 163319717
(3R,7Z,11S)-3,11-diethyl-7-methyl-1-azacyclotetradec-7-en-2-one (PubChem CID 163319717) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is (3R,7Z,11S)-3,11-diethyl-7-methyl-1-azacyclotetradec-7-en-2-one.
| Compound Name | (3R,7Z,11S)-3,11-diethyl-7-methyl-1-azacyclotetradec-7-en-2-one |
|---|---|
| PubChem CID | 163319717 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | (3R,7Z,11S)-3,11-diethyl-7-methyl-1-azacyclotetradec-7-en-2-one |
| SMILES | CC[C@H]1CC/C=C(/C)CCC[C@@H](CC)C(=O)NCCC1 |
| InChI | InChI=1S/C18H33NO/c1-4-16-11-6-9-15(3)10-7-13-17(5-2)18(20)19-14-8-12-16/h9,16-17H,4-8,10-14H2,1-3H3,(H,19,20)/b15-9-/t16-,17+/m0/s1 |
| InChIKey | MADLWGBUSDXTQU-DKJKAOOUSA-N |
| XLogP | 4.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|