C24H47NO2Si — CID 163319723
(3R,6E,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxy-3,11-diethyl-7-methyl-1-azacyclotetradec-6-en-2-one (PubChem CID 163319723) has the molecular formula C24H47NO2Si and a molecular weight of 409.73 g/mol. Its IUPAC name is (3R,6E,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxy-3,11-diethyl-7-methyl-1-azacyclotetradec-6-en-2-one.
| Compound Name | (3R,6E,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxy-3,11-diethyl-7-methyl-1-azacyclotetradec-6-en-2-one |
|---|---|
| PubChem CID | 163319723 |
| Molecular Formula | C24H47NO2Si |
| Molecular Weight | 409.73 g/mol |
| Exact Mass | 409.34 |
| IUPAC Name | (3R,6E,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxy-3,11-diethyl-7-methyl-1-azacyclotetradec-6-en-2-one |
| SMILES | CC[C@@H]1CC/C=C(\C)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CC)CCCNC1=O |
| InChI | InChI=1S/C24H47NO2Si/c1-9-20-15-12-18-25-23(26)21(10-2)14-11-13-19(3)16-17-22(20)27-28(7,8)24(4,5)6/h13,20-22H,9-12,14-18H2,1-8H3,(H,25,26)/b19-13+/t20-,21-,22-/m1/s1 |
| InChIKey | LYAQNEPOYBFZIM-CZYUHHPGSA-N |
| XLogP | 6.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.73 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|