C28H52O5Si — CID 163319755
[(4R,6E,8R,9R,12R,16Z)-8-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-6,9-dimethyl-10-oxooctadeca-6,16-dien-4-yl] acetate (PubChem CID 163319755) has the molecular formula C28H52O5Si and a molecular weight of 496.81 g/mol. Its IUPAC name is [(4R,6E,8R,9R,12R,16Z)-8-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-6,9-dimethyl-10-oxooctadeca-6,16-dien-4-yl] acetate.
| Compound Name | [(4R,6E,8R,9R,12R,16Z)-8-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-6,9-dimethyl-10-oxooctadeca-6,16-dien-4-yl] acetate |
|---|---|
| PubChem CID | 163319755 |
| Molecular Formula | C28H52O5Si |
| Molecular Weight | 496.81 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | [(4R,6E,8R,9R,12R,16Z)-8-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-6,9-dimethyl-10-oxooctadeca-6,16-dien-4-yl] acetate |
| SMILES | C/C=C\CCC[C@@H](O)CC(=O)[C@H](C)[C@@H](/C=C(\C)C[C@@H](CCC)OC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H52O5Si/c1-11-13-14-15-17-24(30)20-26(31)22(4)27(33-34(9,10)28(6,7)8)19-21(3)18-25(16-12-2)32-23(5)29/h11,13,19,22,24-25,27,30H,12,14-18,20H2,1-10H3/b13-11-,21-19+/t22-,24+,25+,27+/m0/s1 |
| InChIKey | GAYLNMROFYMEEL-FAADPPAISA-N |
| XLogP | 7.15 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.81 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|