C17H13Cl2N3O2 — CID 163320560
1-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrazole-4-carboxamide (PubChem CID 163320560) has the molecular formula C17H13Cl2N3O2 and a molecular weight of 362.22 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrazole-4-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 163320560 |
| Molecular Formula | C17H13Cl2N3O2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrazole-4-carboxamide |
| SMILES | COc1ccc(-c2nn(-c3ccc(Cl)cc3Cl)cc2C(N)=O)cc1 |
| InChI | InChI=1S/C17H13Cl2N3O2/c1-24-12-5-2-10(3-6-12)16-13(17(20)23)9-22(21-16)15-7-4-11(18)8-14(15)19/h2-9H,1H3,(H2,20,23) |
| InChIKey | ZZNYUQQXVOJTOL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |