C25H24N2O5 — CID 163321777
6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1,5-dimethyl-3-(2-phenylethyl)quinazoline-2,4-dione (PubChem CID 163321777) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1,5-dimethyl-3-(2-phenylethyl)quinazoline-2,4-dione.
| Compound Name | 6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1,5-dimethyl-3-(2-phenylethyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 163321777 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1,5-dimethyl-3-(2-phenylethyl)quinazoline-2,4-dione |
| SMILES | Cc1c(C(O)=C2C(=O)CCCC2=O)ccc2c1c(=O)n(CCc1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C25H24N2O5/c1-15-17(23(30)22-19(28)9-6-10-20(22)29)11-12-18-21(15)24(31)27(25(32)26(18)2)14-13-16-7-4-3-5-8-16/h3-5,7-8,11-12,30H,6,9-10,13-14H2,1-2H3 |
| InChIKey | WMZIBCPMHJPEQF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|