C12H20N4O4+2 — CID 163321806
4-[(2R,3S)-3-(3,5-dioxopiperazin-1-ium-1-yl)butan-2-yl]piperazin-4-ium-2,6-dione (PubChem CID 163321806) has the molecular formula C12H20N4O4+2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-[(2R,3S)-3-(3,5-dioxopiperazin-1-ium-1-yl)butan-2-yl]piperazin-4-ium-2,6-dione.
| Compound Name | 4-[(2R,3S)-3-(3,5-dioxopiperazin-1-ium-1-yl)butan-2-yl]piperazin-4-ium-2,6-dione |
|---|---|
| PubChem CID | 163321806 |
| Molecular Formula | C12H20N4O4+2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4-[(2R,3S)-3-(3,5-dioxopiperazin-1-ium-1-yl)butan-2-yl]piperazin-4-ium-2,6-dione |
| SMILES | C[C@H]([C@H](C)[NH+]1CC(=O)NC(=O)C1)[NH+]1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C12H18N4O4/c1-7(15-3-9(17)13-10(18)4-15)8(2)16-5-11(19)14-12(20)6-16/h7-8H,3-6H2,1-2H3,(H,13,17,18)(H,14,19,20)/p+2/t7-,8+ |
| InChIKey | OBYGAPWKTPDTAS-OCAPTIKFSA-P |
| XLogP | -5.15 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|