C25H27ClN4O3 — CID 163322265
(2S)-N-[(2S)-1-(benzylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[(2-chloroacetyl)amino]pent-4-enamide (PubChem CID 163322265) has the molecular formula C25H27ClN4O3 and a molecular weight of 466.97 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(benzylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[(2-chloroacetyl)amino]pent-4-enamide.
| Compound Name | (2S)-N-[(2S)-1-(benzylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[(2-chloroacetyl)amino]pent-4-enamide |
|---|---|
| PubChem CID | 163322265 |
| Molecular Formula | C25H27ClN4O3 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | (2S)-N-[(2S)-1-(benzylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[(2-chloroacetyl)amino]pent-4-enamide |
| SMILES | C=CC[C@H](NC(=O)CCl)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H27ClN4O3/c1-2-8-21(29-23(31)14-26)25(33)30-22(24(32)28-15-17-9-4-3-5-10-17)13-18-16-27-20-12-7-6-11-19(18)20/h2-7,9-12,16,21-22,27H,1,8,13-15H2,(H,28,32)(H,29,31)(H,30,33)/t21-,22-/m0/s1 |
| InChIKey | DMHYAQLYAFULCU-VXKWHMMOSA-N |
| XLogP | 2.81 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|