C18H23N3O5 — CID 163322585
butanedioic acid;(6S)-6-(trideuteriomethylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 163322585) has the molecular formula C18H23N3O5 and a molecular weight of 364.42 g/mol. Its IUPAC name is butanedioic acid;(6S)-6-(trideuteriomethylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | butanedioic acid;(6S)-6-(trideuteriomethylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 163322585 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | butanedioic acid;(6S)-6-(trideuteriomethylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | O=C(O)CCC(=O)O.[2H]C([2H])([2H])N[C@H]1CCc2[nH]c3ccc(C(N)=O)cc3c2C1 |
| InChI | InChI=1S/C14H17N3O.C4H6O4/c1-16-9-3-5-13-11(7-9)10-6-8(14(15)18)2-4-12(10)17-13;5-3(6)1-2-4(7)8/h2,4,6,9,16-17H,3,5,7H2,1H3,(H2,15,18);1-2H2,(H,5,6)(H,7,8)/t9-;/m0./s1/i1D3; |
| InChIKey | WHTHWNUUXINXHN-SSUNAKLMSA-N |
| XLogP | 1.28 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|