C22H21N5O — CID 163322934
3-phenyl-N-(4-piperidin-1-ylphenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-amine (PubChem CID 163322934) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-phenyl-N-(4-piperidin-1-ylphenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-amine.
| Compound Name | 3-phenyl-N-(4-piperidin-1-ylphenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 163322934 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 3-phenyl-N-(4-piperidin-1-ylphenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
| SMILES | c1ccc(-c2noc3ncnc(Nc4ccc(N5CCCCC5)cc4)c23)cc1 |
| InChI | InChI=1S/C22H21N5O/c1-3-7-16(8-4-1)20-19-21(23-15-24-22(19)28-26-20)25-17-9-11-18(12-10-17)27-13-5-2-6-14-27/h1,3-4,7-12,15H,2,5-6,13-14H2,(H,23,24,25) |
| InChIKey | YHSHWBCTMCRTOH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|