C9H10N4S — CID 163322973
1,3,3a,4,4a,5-hexahydroimidazo[4,5-b][1,8]naphthyridine-2-thione (PubChem CID 163322973) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is 1,3,3a,4,4a,5-hexahydroimidazo[4,5-b][1,8]naphthyridine-2-thione.
| Compound Name | 1,3,3a,4,4a,5-hexahydroimidazo[4,5-b][1,8]naphthyridine-2-thione |
|---|---|
| PubChem CID | 163322973 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 1,3,3a,4,4a,5-hexahydroimidazo[4,5-b][1,8]naphthyridine-2-thione |
| SMILES | S=C1NC2=CC3=CC=CNC3NC2N1 |
| InChI | InChI=1S/C9H10N4S/c14-9-11-6-4-5-2-1-3-10-7(5)12-8(6)13-9/h1-4,7-8,10,12H,(H2,11,13,14) |
| InChIKey | PKZOWDZQGYPQFX-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|