C15H12N2O6 — CID 163323485
2-[(3R)-3-methyl-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 163323485) has the molecular formula C15H12N2O6 and a molecular weight of 316.27 g/mol. Its IUPAC name is 2-[(3R)-3-methyl-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[(3R)-3-methyl-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 163323485 |
| Molecular Formula | C15H12N2O6 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-[(3R)-3-methyl-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | C[C@@]1(N2C(=O)c3ccc(C(=O)O)cc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C15H12N2O6/c1-15(5-4-10(18)16-14(15)23)17-11(19)8-3-2-7(13(21)22)6-9(8)12(17)20/h2-3,6H,4-5H2,1H3,(H,21,22)(H,16,18,23)/t15-/m1/s1 |
| InChIKey | VWVJRXADTDRXRW-OAHLLOKOSA-N |
| XLogP | 0.18 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|